EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O2 |
| Net Charge | 0 |
| Average Mass | 410.642 |
| Monoisotopic Mass | 410.31848 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+/t28-/m1/s1 |
| InChIKey | OTXNTMVVOOBZCV-WAZJVIJMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-tocotrienol (CHEBI:33277) has role antineoplastic agent (CHEBI:35610) |
| γ-tocotrienol (CHEBI:33277) has role antioxidant (CHEBI:22586) |
| γ-tocotrienol (CHEBI:33277) has role apoptosis inducer (CHEBI:68495) |
| γ-tocotrienol (CHEBI:33277) has role hepatoprotective agent (CHEBI:62868) |
| γ-tocotrienol (CHEBI:33277) has role plant metabolite (CHEBI:76924) |
| γ-tocotrienol (CHEBI:33277) has role radiation protective agent (CHEBI:66987) |
| γ-tocotrienol (CHEBI:33277) is a tocotrienol (CHEBI:33235) |
| γ-tocotrienol (CHEBI:33277) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| gamma-tocotrienol | KEGG COMPOUND |
| (2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| γ-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14155 | KEGG COMPOUND |
| LMPR02020057 | LIPID MAPS |
| HMDB0012958 | HMDB |
| Gamma-Tocotrienol | Wikipedia |
| CPD-15838 | MetaCyc |
| FDB001298 | FooDB |
| C00035101 | KNApSAcK |
| 4445514 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:43525 | Beilstein |
| Reaxys:5483919 | Reaxys |
| CAS:14101-61-2 | ChemIDplus |
| CAS:14101-61-2 | NIST Chemistry WebBook |
| Citations |
|---|