EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O2 |
| Net Charge | 0 |
| Average Mass | 410.642 |
| Monoisotopic Mass | 410.31848 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+/t28-/m1/s1 |
| InChIKey | OTXNTMVVOOBZCV-WAZJVIJMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-tocotrienol (CHEBI:33277) has role antineoplastic agent (CHEBI:35610) |
| γ-tocotrienol (CHEBI:33277) has role antioxidant (CHEBI:22586) |
| γ-tocotrienol (CHEBI:33277) has role apoptosis inducer (CHEBI:68495) |
| γ-tocotrienol (CHEBI:33277) has role hepatoprotective agent (CHEBI:62868) |
| γ-tocotrienol (CHEBI:33277) has role plant metabolite (CHEBI:76924) |
| γ-tocotrienol (CHEBI:33277) has role radiation protective agent (CHEBI:66987) |
| γ-tocotrienol (CHEBI:33277) is a tocotrienol (CHEBI:33235) |
| γ-tocotrienol (CHEBI:33277) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| gamma-tocotrienol | KEGG COMPOUND |
| (2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| γ-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14155 | KEGG COMPOUND |
| LMPR02020057 | LIPID MAPS |
| HMDB0012958 | HMDB |
| Gamma-Tocotrienol | Wikipedia |
| CPD-15838 | MetaCyc |
| FDB001298 | FooDB |
| C00035101 | KNApSAcK |
| 4445514 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:43525 | Beilstein |
| Reaxys:5483919 | Reaxys |
| CAS:14101-61-2 | ChemIDplus |
| CAS:14101-61-2 | NIST Chemistry WebBook |
| Citations |
|---|