EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3508 - ceftazidime
| Formula | C22H22N6O7S2 |
| Net Charge | 0 |
| Average Mass | 546.587 |
| Monoisotopic Mass | 546.09914 |
| SMILES | [H][C@]12SCC(C[n+]3ccccc3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C22H22N6O7S2/c1-22(2,20(33)34)35-26-13(12-10-37-21(23)24-12)16(29)25-14-17(30)28-15(19(31)32)11(9-36-18(14)28)8-27-6-4-3-5-7-27/h3-7,10,14,18H,8-9H2,1-2H3,(H4-,23,24,25,29,31,32,33,34)/b26-13-/t14-,18-/m1/s1 |
| InChIKey | ORFOPKXBNMVMKC-DWVKKRMSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of peptidoglycan glycosyltransferase (EC 2.4.1.129). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftazidime (CHEBI:3508) has role antibacterial agent (CHEBI:33282) |
| ceftazidime (CHEBI:3508) has role antibacterial drug (CHEBI:36047) |
| ceftazidime (CHEBI:3508) has role antiinfective agent (CHEBI:35441) |
| ceftazidime (CHEBI:3508) has role antimicrobial agent (CHEBI:33281) |
| ceftazidime (CHEBI:3508) has role drug allergen (CHEBI:88188) |
| ceftazidime (CHEBI:3508) has role EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor (CHEBI:50696) |
| ceftazidime (CHEBI:3508) is a cephalosporin (CHEBI:23066) |
| ceftazidime (CHEBI:3508) is a oxime O-ether (CHEBI:36816) |
| ceftazidime (CHEBI:3508) is conjugate acid of ceftazidime(1−) (CHEBI:53676) |
| Incoming Relation(s) |
| ceftazidime pentahydrate (CHEBI:3509) has part ceftazidime (CHEBI:3508) |
| ceftazidime sodium (CHEBI:53675) has part ceftazidime (CHEBI:3508) |
| ceftazidime(1−) (CHEBI:53676) is conjugate base of ceftazidime (CHEBI:3508) |
| IUPAC Name |
|---|
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-(pyridinium-1-ylmethyl)-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| ceftazidima | DrugBank |
| ceftazidime | KEGG DRUG |
| ceftazidimum | DrugBank |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-8-oxo-3-(pyridinium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| CAZ | KEGG DRUG |
| Ceftazidime anhydrous | ChemIDplus |
| Ceftazidime (arginine formulation) | ChEMBL |
| GR 20263 | ChEMBL |
| GR-20263 | ChEMBL |
| Brand Names | Source |
|---|---|
| Ceftazidime component of avycaz | ChEMBL |
| Ceftazidime component of zavicefta | ChEMBL |
| Ceptaz | ChEMBL |
| Fortam | ChEMBL |
| Fortaz | ChEMBL |
| Fortum | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5475149 | Reaxys |
| CAS:72558-82-8 | KEGG DRUG |
| CAS:72558-82-8 | KEGG COMPOUND |
| CAS:72558-82-8 | ChemIDplus |
| Citations |
|---|