EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N6O7S2 |
| Net Charge | 0 |
| Average Mass | 546.587 |
| Monoisotopic Mass | 546.09914 |
| SMILES | [H][C@]12SCC(C[n+]3ccccc3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C22H22N6O7S2/c1-22(2,20(33)34)35-26-13(12-10-37-21(23)24-12)16(29)25-14-17(30)28-15(19(31)32)11(9-36-18(14)28)8-27-6-4-3-5-7-27/h3-7,10,14,18H,8-9H2,1-2H3,(H4-,23,24,25,29,31,32,33,34)/b26-13-/t14-,18-/m1/s1 |
| InChIKey | ORFOPKXBNMVMKC-DWVKKRMSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of peptidoglycan glycosyltransferase (EC 2.4.1.129). drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftazidime (CHEBI:3508) has role antibacterial drug (CHEBI:36047) |
| ceftazidime (CHEBI:3508) has role drug allergen (CHEBI:88188) |
| ceftazidime (CHEBI:3508) has role EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor (CHEBI:50696) |
| ceftazidime (CHEBI:3508) is a cephalosporin (CHEBI:23066) |
| ceftazidime (CHEBI:3508) is a oxime O-ether (CHEBI:36816) |
| ceftazidime (CHEBI:3508) is conjugate acid of ceftazidime(1−) (CHEBI:53676) |
| Incoming Relation(s) |
| ceftazidime pentahydrate (CHEBI:3509) has part ceftazidime (CHEBI:3508) |
| ceftazidime sodium (CHEBI:53675) has part ceftazidime (CHEBI:3508) |
| ceftazidime(1−) (CHEBI:53676) is conjugate base of ceftazidime (CHEBI:3508) |
| IUPAC Name |
|---|
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-(pyridinium-1-ylmethyl)-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| ceftazidima | DrugBank |
| ceftazidime | KEGG DRUG |
| ceftazidimum | DrugBank |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-8-oxo-3-(pyridinium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| CAZ | KEGG DRUG |
| Ceftazidime anhydrous | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5475149 | Reaxys |
| CAS:72558-82-8 | KEGG COMPOUND |
| CAS:72558-82-8 | KEGG DRUG |
| CAS:72558-82-8 | ChemIDplus |
| Citations |
|---|