EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N6O7S2 |
| Net Charge | 0 |
| Average Mass | 546.587 |
| Monoisotopic Mass | 546.09914 |
| SMILES | [H][C@]12SCC(C[n+]3ccccc3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C22H22N6O7S2/c1-22(2,20(33)34)35-26-13(12-10-37-21(23)24-12)16(29)25-14-17(30)28-15(19(31)32)11(9-36-18(14)28)8-27-6-4-3-5-7-27/h3-7,10,14,18H,8-9H2,1-2H3,(H4-,23,24,25,29,31,32,33,34)/b26-13-/t14-,18-/m1/s1 |
| InChIKey | ORFOPKXBNMVMKC-DWVKKRMSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of peptidoglycan glycosyltransferase (EC 2.4.1.129). drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftazidime (CHEBI:3508) has role antibacterial drug (CHEBI:36047) |
| ceftazidime (CHEBI:3508) has role drug allergen (CHEBI:88188) |
| ceftazidime (CHEBI:3508) has role EC 2.4.1.129 (peptidoglycan glycosyltransferase) inhibitor (CHEBI:50696) |
| ceftazidime (CHEBI:3508) is a cephalosporin (CHEBI:23066) |
| ceftazidime (CHEBI:3508) is a oxime O-ether (CHEBI:36816) |
| ceftazidime (CHEBI:3508) is conjugate acid of ceftazidime(1−) (CHEBI:53676) |
| Incoming Relation(s) |
| ceftazidime pentahydrate (CHEBI:3509) has part ceftazidime (CHEBI:3508) |
| ceftazidime sodium (CHEBI:53675) has part ceftazidime (CHEBI:3508) |
| ceftazidime(1−) (CHEBI:53676) is conjugate base of ceftazidime (CHEBI:3508) |
| IUPAC Name |
|---|
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-(pyridinium-1-ylmethyl)-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| ceftazidima | DrugBank |
| ceftazidime | KEGG DRUG |
| ceftazidimum | DrugBank |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-8-oxo-3-(pyridinium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| CAZ | KEGG DRUG |
| Ceftazidime anhydrous | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5475149 | Reaxys |
| CAS:72558-82-8 | KEGG COMPOUND |
| CAS:72558-82-8 | KEGG DRUG |
| CAS:72558-82-8 | ChemIDplus |
| Citations |
|---|