EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N4O8S2 |
| Net Charge | 0 |
| Average Mass | 532.556 |
| Monoisotopic Mass | 532.07226 |
| SMILES | [H][C@]12SCC(C[n+]3ccc(C(N)=O)cc3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@@H](c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C22H20N4O8S2/c23-18(27)13-6-8-25(9-7-13)10-14-11-35-21-15(20(29)26(21)16(14)22(30)31)24-19(28)17(36(32,33)34)12-4-2-1-3-5-12/h1-9,15,17,21H,10-11H2,(H4-,23,24,27,28,30,31,32,33,34)/t15-,17-,21-/m1/s1 |
| InChIKey | SYLKGLMBLAAGSC-QLVMHMETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefsulodin (CHEBI:3507) has role antibacterial drug (CHEBI:36047) |
| cefsulodin (CHEBI:3507) is a cephalosporin (CHEBI:23066) |
| cefsulodin (CHEBI:3507) is a organosulfonic acid (CHEBI:33551) |
| cefsulodin (CHEBI:3507) is a primary carboxamide (CHEBI:140324) |
| IUPAC Names |
|---|
| (6R,7R)-3-[(4-carbamoylpyridinium-1-yl)methyl]-8-oxo-7-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| 7β-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-3-(4-carbamoylpyridinium-1-yl)methyl-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefsulodin | ChemIDplus |
| cefsulodine | ChemIDplus |
| cefsulodino | ChemIDplus |
| cefsulodinum | ChemIDplus |
| Synonym | Source |
|---|---|
| Cefsulodin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11253 | KEGG COMPOUND |
| D07653 | KEGG DRUG |
| Cefsulodin | Wikipedia |
| 558 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:62587-73-9 | KEGG COMPOUND |
| CAS:62587-73-9 | ChemIDplus |
| Citations |
|---|