EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O2 |
| Net Charge | 0 |
| Average Mass | 416.690 |
| Monoisotopic Mass | 416.36543 |
| SMILES | Cc1cc(O)c(C)c2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)26(29)19-23(5)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1 |
| InChIKey | WGVKWNUPNGFDFJ-DQCZWYHMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (262184) | ||
| Panax ginseng (ncbitaxon:4054) | - | MetaboLights (MTBLS350) | From MetaboLights |
| Helianthus annuus (ncbitaxon:4232) | seed (PO:0009010) | DOI (10.1007/s11032-005-5678-5) | |
| Quercus rubra (ncbitaxon:3512) | - | DOI (10.1007/s00217-018-3150-0) | |
| Quercus robur (ncbitaxon:38942) | - | DOI (10.1007/s00217-018-3150-0) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-tocopherol (CHEBI:47771) has role food component (CHEBI:78295) |
| β-tocopherol (CHEBI:47771) has role plant metabolite (CHEBI:76924) |
| β-tocopherol (CHEBI:47771) is a tocopherol (CHEBI:27013) |
| β-tocopherol (CHEBI:47771) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (R,R,R)-β-tocopherol | ChEBI |
| 5,8-dimethyltocol | ChEBI |
| (2R)-3,4-dihydro-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol | ChemIDplus |
| beta-Tocopherol | KEGG COMPOUND |
| (2R,4'R,8'R)-β-tocopherol | ChEBI |
| (2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| β-tocopherol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14152 | KEGG COMPOUND |
| Beta-Tocopherol | Wikipedia |
| HMDB0006335 | HMDB |
| C00007364 | KNApSAcK |
| BETA-TOCOPHEROL | MetaCyc |
| LMPR02020059 | LIPID MAPS |
| FDB012381 | FooDB |
| 5256784 | ChemSpider |
| ES2232276 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:93070 | Beilstein |
| Reaxys:93070 | Reaxys |
| CAS:16698-35-4 | ChemIDplus |
| CAS:148-03-8 | KEGG COMPOUND |
| Citations |
|---|