EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O2 |
| Net Charge | 0 |
| Average Mass | 424.669 |
| Monoisotopic Mass | 424.33413 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C29H44O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h12,14,16,30H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16+/t29-/m1/s1 |
| InChIKey | RZFHLOLGZPDCHJ-XZXLULOTSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (12739983) | ||
| Panax ginseng (ncbitaxon:4054) | - | MetaboLights (MTBLS350) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-tocotrienol (CHEBI:33270) has role ferroptosis inhibitor (CHEBI:173084) |
| α-tocotrienol (CHEBI:33270) has role human metabolite (CHEBI:77746) |
| α-tocotrienol (CHEBI:33270) has role neuroprotective agent (CHEBI:63726) |
| α-tocotrienol (CHEBI:33270) has role plant metabolite (CHEBI:76924) |
| α-tocotrienol (CHEBI:33270) is a tocotrienol (CHEBI:33235) |
| α-tocotrienol (CHEBI:33270) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| alpha-tocotrienol | LIPID MAPS |
| alpha-tocotrienol | KEGG COMPOUND |
| zeta1-tocopherol | LIPID MAPS |
| α-tocotrienol | ChemIDplus |
| ζ1-tocopherol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| α-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4445512 | ChemSpider |
| Alpha-Tocotrienol | Wikipedia |
| C00035044 | KNApSAcK |
| C14153 | KEGG COMPOUND |
| CPD-15836 | MetaCyc |
| EP2362875 | Patent |
| FDB002434 | FooDB |
| HMDB0006327 | HMDB |
| LMPR02020054 | LIPID MAPS |
| US2010105930 | Patent |
| WO2010051277 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:45723 | Beilstein |
| Reaxys:5484296 | Reaxys |
| CAS:1721-51-3 | ChemIDplus |
| CAS:1721-51-3 | KEGG COMPOUND |
| Citations |
|---|