EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N3O5S |
| Net Charge | 0 |
| Average Mass | 389.433 |
| Monoisotopic Mass | 389.10454 |
| SMILES | [H][C@]12SCC(C=CC)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1 |
| InChIKey | WDLWHQDACQUCJR-PBFPGSCMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefprozil (CHEBI:3506) has role antibacterial drug (CHEBI:36047) |
| cefprozil (CHEBI:3506) is a cephalosporin (CHEBI:23066) |
| cefprozil (CHEBI:3506) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3-(prop-1-en-1-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| cefprozil | WHO MedNet |
| cefprozil | WHO MedNet |
| cefprozilo | ChemIDplus |
| cefprozilum | ChemIDplus |
| Synonym | Source |
|---|---|
| Cefprozil anhydrous | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Cefzil | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8167198 | Beilstein |
| CAS:92665-29-7 | ChemIDplus |
| CAS:92665-29-7 | KEGG COMPOUND |
| Citations |
|---|