EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30N4 |
| Net Charge | +2 |
| Average Mass | 494.642 |
| Monoisotopic Mass | 494.24595 |
| SMILES | c1cc2cc(c1)C[n+]1ccc(c3ccccc31)NCc1ccc(cc1)CNc1cc[n+](c3ccccc13)C2 |
| InChI | InChI=1S/C34H28N4/c1-3-10-33-29(8-1)31-16-18-37(33)23-27-6-5-7-28(20-27)24-38-19-17-32(30-9-2-4-11-34(30)38)36-22-26-14-12-25(13-15-26)21-35-31/h1-20H,21-24H2/p+2/b35-31+,36-32+ |
| InChIKey | HZWVJPDDZQOYGA-QUTRQNJUSA-P |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UCL 1684 (CHEBI:35040) has role anti-arrhythmia drug (CHEBI:38070) |
| UCL 1684 (CHEBI:35040) has role potassium channel blocker (CHEBI:50509) |
| UCL 1684 (CHEBI:35040) is a aromatic amine (CHEBI:33860) |
| UCL 1684 (CHEBI:35040) is a azamacrocycle (CHEBI:52898) |
| UCL 1684 (CHEBI:35040) is a benzenes (CHEBI:22712) |
| UCL 1684 (CHEBI:35040) is a quinolinium ion (CHEBI:52837) |
| UCL 1684 (CHEBI:35040) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10(15),11,13,16(36),19,21,25(33),26(31),27,29,34-hexadecaene |
| Synonyms | Source |
|---|---|
| 11λ5,51λ5-6,10-diaza-3(1,3),8(1,4)-dibenzena-1,5(1,4)-diquinolinacyclodecaphane-11,51-bis(ylium) | ChEBI |
| 1λ5,9λ5,17,24-tetraazaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10(15),11,13,16(36),19,21,25(33),26(31),27,29,34-hexadecaene-1,9-bis(ylium) | IUPAC |
| 6,10-diaza-3(1,3),8(1,4)-dibenzena-1,5(1,4)-diquinolinacyclodecaphane | KEGG COMPOUND |
| UCL-1684 | ChEBI |
| UCL1684 | ChEBI |
| Citations |
|---|