EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H39O7P |
| Net Charge | 0 |
| Average Mass | 398.477 |
| Monoisotopic Mass | 398.24334 |
| SMILES | CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC |
| InChI | InChI=1S/C18H39O7P/c1-4-7-10-20-13-16-23-26(19,24-17-14-21-11-8-5-2)25-18-15-22-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | WTLBZVNBAKMVDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Application: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tris(2-butoxyethyl) phosphate (CHEBI:35038) has role environmental contaminant (CHEBI:78298) |
| tris(2-butoxyethyl) phosphate (CHEBI:35038) has role flame retardant (CHEBI:79314) |
| tris(2-butoxyethyl) phosphate (CHEBI:35038) is a trialkyl phosphate (CHEBI:37562) |
| IUPAC Name |
|---|
| tris(2-butoxyethyl) phosphate |
| Synonyms | Source |
|---|---|
| Phosphoric acid, tri-(2-butoxyethyl) ester | NIST Chemistry WebBook |
| Phosphoric acid, tris(2-butoxyethyl) ester | ChemIDplus |
| TBEP | ChemIDplus |
| Tri(2-butoxyethyl) phosphate | ChemIDplus |
| Tris(2-butoxyethyl) phosphate | KEGG COMPOUND |
| Tris(butoxyethyl)phosphate | KEGG COMPOUND |
| Citations |
|---|