EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClSn |
| Net Charge | 0 |
| Average Mass | 385.482 |
| Monoisotopic Mass | 385.98842 |
| SMILES | [Cl][Sn]([c]1ccccc1)([c]1ccccc1)[c]1ccccc1 |
| InChI | InChI=1S/3C6H5.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1 |
| InChIKey | NJVOZLGKTAPUTQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fentin chloride (CHEBI:35036) has functional parent triphenylstannane (CHEBI:30537) |
| fentin chloride (CHEBI:35036) has role antifungal agrochemical (CHEBI:86328) |
| fentin chloride (CHEBI:35036) has role immunosuppressive agent (CHEBI:35705) |
| fentin chloride (CHEBI:35036) is a chlorine molecular entity (CHEBI:23117) |
| fentin chloride (CHEBI:35036) is a organotin compound (CHEBI:25717) |
| Synonyms | Source |
|---|---|
| Chlorotriphenylstannane | ChemIDplus |
| Chlorotriphenyltin | ChemIDplus |
| TPTC | NIST Chemistry WebBook |
| Triphenylchlorostannane | ChemIDplus |
| Triphenylchlorotin | NIST Chemistry WebBook |
| triphenylstannylium chloride | Alan Wood's Pesticides |
| Citations |
|---|