EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClSn |
| Net Charge | 0 |
| Average Mass | 385.482 |
| Monoisotopic Mass | 385.98842 |
| SMILES | [Cl][Sn]([c]1ccccc1)([c]1ccccc1)[c]1ccccc1 |
| InChI | InChI=1S/3C6H5.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1 |
| InChIKey | NJVOZLGKTAPUTQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fentin chloride (CHEBI:35036) has functional parent triphenylstannane (CHEBI:30537) |
| fentin chloride (CHEBI:35036) has role antifungal agrochemical (CHEBI:86328) |
| fentin chloride (CHEBI:35036) has role immunosuppressive agent (CHEBI:35705) |
| fentin chloride (CHEBI:35036) is a chlorine molecular entity (CHEBI:23117) |
| fentin chloride (CHEBI:35036) is a organotin compound (CHEBI:25717) |
| Synonyms | Source |
|---|---|
| Triphenyltin chloride | KEGG COMPOUND |
| Triphenylchlorostannane | ChemIDplus |
| TPTC | NIST Chemistry WebBook |
| Triphenylchlorotin | NIST Chemistry WebBook |
| Chlorotriphenyltin | ChemIDplus |
| Triphenyltin chloride | ChemIDplus |
| Citations |
|---|