EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15O4P |
| Net Charge | 0 |
| Average Mass | 326.288 |
| Monoisotopic Mass | 326.07080 |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| InChIKey | XZZNDPSIHUTMOC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphenyl phosphate (CHEBI:35033) has functional parent phenol (CHEBI:15882) |
| triphenyl phosphate (CHEBI:35033) has role flame retardant (CHEBI:79314) |
| triphenyl phosphate (CHEBI:35033) has role plasticiser (CHEBI:79056) |
| triphenyl phosphate (CHEBI:35033) is a aryl phosphate (CHEBI:36943) |
| IUPAC Name |
|---|
| triphenyl phosphate |
| Synonyms | Source |
|---|---|
| Phosphoric acid, triphenyl ester | ChEBI |
| TPP | ChemIDplus |
| Triphenoxyphosphine oxide | ChemIDplus |
| Triphenyl phosphate | KEGG COMPOUND |
| Triphenylphosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14235 | KEGG COMPOUND |
| Triphenyl_phosphate | Wikipedia |
| Citations |
|---|