EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N6O5S2 |
| Net Charge | 0 |
| Average Mass | 514.589 |
| Monoisotopic Mass | 514.10931 |
| SMILES | [H][C@]12SCC(C[n+]3cccc4c3CCC4)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C22H22N6O5S2/c1-33-26-15(13-10-35-22(23)24-13)18(29)25-16-19(30)28-17(21(31)32)12(9-34-20(16)28)8-27-7-3-5-11-4-2-6-14(11)27/h3,5,7,10,16,20H,2,4,6,8-9H2,1H3,(H3-,23,24,25,29,31,32)/b26-15-/t16-,20-/m1/s1 |
| InChIKey | DKOQGJHPHLTOJR-WHRDSVKCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefpirome (CHEBI:3503) is a cephalosporin (CHEBI:23066) |
| cefpirome (CHEBI:3503) is a cyclopentapyridine (CHEBI:37940) |
| Incoming Relation(s) |
| cefpirome sulfate (CHEBI:31378) has functional parent cefpirome (CHEBI:3503) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-(6,7-dihydro-5H-cyclopenta[b]pyridinium-1-ylmethyl)-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefpiroma | ChemIDplus |
| cefpirome | ChemIDplus |
| cefpiromum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-(6,7-dihydro-5H-cyclopenta[b]pyridinium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Cefpirome | KEGG COMPOUND |
| cefrom | DrugCentral |
| HR 810 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4241500 | Reaxys |
| CAS:84957-29-9 | ChemIDplus |
| CAS:84957-29-9 | KEGG COMPOUND |
| Citations |
|---|