EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16F3N3O4 |
| Net Charge | 0 |
| Average Mass | 335.282 |
| Monoisotopic Mass | 335.10929 |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16F3N3O4/c1-3-5-17(6-4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZSDSQXJSNMTJDA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifluralin (CHEBI:35027) has role agrochemical (CHEBI:33286) |
| trifluralin (CHEBI:35027) has role environmental contaminant (CHEBI:78298) |
| trifluralin (CHEBI:35027) has role herbicide (CHEBI:24527) |
| trifluralin (CHEBI:35027) has role xenobiotic (CHEBI:35703) |
| trifluralin (CHEBI:35027) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| trifluralin (CHEBI:35027) is a C-nitro compound (CHEBI:35716) |
| trifluralin (CHEBI:35027) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline |
| Synonyms | Source |
|---|---|
| α,α,α-trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine | NIST Chemistry WebBook |
| 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)benzenamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C14343 | KEGG COMPOUND |
| Trifluralin | Wikipedia |
| trifluralin | Alan Wood's Pesticides |
| 667 | PPDB |
| Citations |
|---|