EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35020 - tributyrin
| Formula | C15H26O6 |
| Net Charge | 0 |
| Average Mass | 302.367 |
| Monoisotopic Mass | 302.17294 |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | UYXTWWCETRIEDR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tributyrin (CHEBI:35020) has functional parent butyric acid (CHEBI:30772) |
| tributyrin (CHEBI:35020) has role antineoplastic agent (CHEBI:35610) |
| tributyrin (CHEBI:35020) has role apoptosis inducer (CHEBI:68495) |
| tributyrin (CHEBI:35020) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| tributyrin (CHEBI:35020) has role prodrug (CHEBI:50266) |
| tributyrin (CHEBI:35020) has role protective agent (CHEBI:50267) |
| tributyrin (CHEBI:35020) is a butyrate ester (CHEBI:50477) |
| tributyrin (CHEBI:35020) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl tributanoate |
| Synonyms | Source |
|---|---|
| Glyceryl tributyrate | KEGG COMPOUND |
| Glycerol tributyrate | KEGG COMPOUND |
| Glycerol tributanoate | ChemIDplus |
| Tri-n-butyrin | ChemIDplus |
| Tributin | ChemIDplus |
| Glyceryl tributyrate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 1,2,3-tributanoylglycerol | UniProt |
| Citations |
|---|