EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N9O5S2 |
| Net Charge | 0 |
| Average Mass | 515.537 |
| Monoisotopic Mass | 515.07941 |
| SMILES | [H][C@]12SCC(C[n+]3ccn4ncccc43)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1nsc(N)n1 |
| InChI | InChI=1S/C19H17N9O5S2/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32)/b24-11-/t12-,17-/m1/s1 |
| InChIKey | QDUIJCOKQCCXQY-WHJQOFBOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefozopran (CHEBI:3502) is a cephalosporin (CHEBI:23066) |
| cefozopran (CHEBI:3502) is a imidazopyridazine (CHEBI:48382) |
| cefozopran (CHEBI:3502) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-(imidazo[1,2-b]pyridazin-1-ium-1-ylmethyl)-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefozopran | ChemIDplus |
| cefozoprán | WHO MedNet |
| céfozopran | WHO MedNet |
| cefozopranum | WHO MedNet |
| Synonym | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methoxyimino)acetyl]amino}-3-(imidazo[1,2-b]pyridazin-1-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| D01052 | KEGG DRUG |
| Cefozopran | Wikipedia |
| 8398449 | Wikipedia |
| WO2010089729 | Patent |
| CN1847247 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:113359-04-9 | KEGG COMPOUND |
| Citations |
|---|