EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O2 |
| Net Charge | 0 |
| Average Mass | 270.372 |
| Monoisotopic Mass | 270.16198 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)C=CC1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | MEHHPFQKXOUFFV-OWSLCNJRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dendropanax trifidus (ncbitaxon:96665) | - | PubMed (34959884) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trenbolone (CHEBI:35018) has role endocrine disruptor (CHEBI:138015) |
| trenbolone (CHEBI:35018) has role plant metabolite (CHEBI:76924) |
| trenbolone (CHEBI:35018) is a 17β-hydroxy steroid (CHEBI:35343) |
| trenbolone (CHEBI:35018) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| trenbolone (CHEBI:35018) is a anabolic androgenic steroid (CHEBI:50786) |
| trenbolone (CHEBI:35018) is a C18-steroid (CHEBI:131591) |
| IUPAC Name |
|---|
| 17β-hydroxyestra-4,9,11-trien-3-one |
| INNs | Source |
|---|---|
| trenbolona | WHO MedNet |
| trenbolone | WHO MedNet |
| trenbolone | WHO MedNet |
| trenbolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17-beta-hydroxyestra-4,9,11-trien-3-one | ChemIDplus |
| (17β)-17-hydroxyestra-4,9,11-trien-3-one | ChEBI |
| 17β-trenbolone | ChemIDplus |
| 9,10,11,12-dehydro-19-nortestosterone | ChEBI |
| estra-4,9,11-trien-17β-ol-3-one | ChEBI |
| RU 2341 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 23383 | ChemSpider |
| C14261 | KEGG COMPOUND |
| D08627 | KEGG DRUG |
| DB11551 | DrugBank |
| Trenbolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5756203 | Reaxys |
| CAS:10161-33-8 | NIST Chemistry WebBook |
| CAS:10161-33-8 | ChemIDplus |
| Citations |
|---|