EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4S |
| Net Charge | 0 |
| Average Mass | 150.155 |
| Monoisotopic Mass | 149.99868 |
| SMILES | O=C(O)CSCC(=O)O |
| InChI | InChI=1S/C4H6O4S/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| InChIKey | UVZICZIVKIMRNE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiodiacetic acid (CHEBI:35012) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2,2'-thiodiacetic acid |
| Synonyms | Source |
|---|---|
| 2,2'-thiobisacetic acid | ChemIDplus |
| 2,2'-thiodiethanoic acid | ChemIDplus |
| (carboxymethylthio)acetic acid | ChemIDplus |
| dicarboxymethyl sulfide | ChemIDplus |
| thiodi(acetic acid) | ChemIDplus |
| Thiodiacetic acid | KEGG COMPOUND |