EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N3O7S2.Na |
| Net Charge | 0 |
| Average Mass | 449.442 |
| Monoisotopic Mass | 449.03274 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)[O-])N1C(=O)[C@]2(NC(=O)Cc1cccs1)OC.[Na+] |
| InChI | InChI=1S/C16H17N3O7S2.Na/c1-25-16(18-10(20)5-9-3-2-4-27-9)13(23)19-11(12(21)22)8(6-26-15(17)24)7-28-14(16)19;/h2-4,14H,5-7H2,1H3,(H2,17,24)(H,18,20)(H,21,22);/q;+1/p-1/t14-,16+;/m1./s1 |
| InChIKey | GNWUOVJNSFPWDD-XMZRARIVSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cefoxitin sodium (CHEBI:3501) has role antiinfective agent (CHEBI:35441) |
| Cefoxitin sodium (CHEBI:3501) has role antimicrobial agent (CHEBI:33281) |
| Cefoxitin sodium (CHEBI:3501) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Cefoxitin sodium | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Mefoxin | ChEMBL |
| Citations |
|---|