EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O3 |
| Net Charge | 0 |
| Average Mass | 337.379 |
| Monoisotopic Mass | 337.14264 |
| SMILES | CC(=O)N1N=C(c2ccc(N)cc2)c2cc3c(cc2C[C@H]1C)OCO3 |
| InChI | InChI=1S/C19H19N3O3/c1-11-7-14-8-17-18(25-10-24-17)9-16(14)19(21-22(11)12(2)23)13-3-5-15(20)6-4-13/h3-6,8-9,11H,7,10,20H2,1-2H3/t11-/m1/s1 |
| InChIKey | JACAAXNEHGBPOQ-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talampanel (CHEBI:34992) has role anticonvulsant (CHEBI:35623) |
| Talampanel (CHEBI:34992) has role antineoplastic agent (CHEBI:35610) |
| Talampanel (CHEBI:34992) has role antiparkinson drug (CHEBI:48407) |
| Talampanel (CHEBI:34992) is a benzodioxoles (CHEBI:38298) |
| Synonyms | Source |
|---|---|
| GYKI-53773 | ChEMBL |
| Ly300164 | ChEMBL |
| LY-300164 | ChEMBL |
| (-)-talampanel | ChEMBL |
| Talampanel | KEGG COMPOUND |
| Citations |
|---|