EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N7O8S4 |
| Net Charge | 0 |
| Average Mass | 575.632 |
| Monoisotopic Mass | 575.00214 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)C1SC(=C(C(N)=O)C(=O)O)S1)OC |
| InChI | InChI=1S/C17H17N7O8S4/c1-23-16(20-21-22-23)34-4-5-3-33-15-17(32-2,14(31)24(15)7(5)11(29)30)19-9(26)13-35-12(36-13)6(8(18)25)10(27)28/h13,15H,3-4H2,1-2H3,(H2,18,25)(H,19,26)(H,27,28)(H,29,30)/b12-6-/t13?,15-,17+/m1/s1 |
| InChIKey | SRZNHPXWXCNNDU-IXOPCIAXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotetan (CHEBI:3499) has role antibacterial drug (CHEBI:36047) |
| cefotetan (CHEBI:3499) is a cephamycin (CHEBI:55429) |
| cefotetan (CHEBI:3499) is conjugate acid of cefotetan(2−) (CHEBI:59358) |
| Incoming Relation(s) |
| cefotetan(2−) (CHEBI:59358) is conjugate base of cefotetan (CHEBI:3499) |
| IUPAC Names |
|---|
| (6R,7S)-7-({[4-(2-amino-1-carboxy-2-oxoethylidene)-1,3-dithietan-2-yl]carbonyl}amino)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-({[4-(2-amino-1-carboxy-2-oxoethylidene)-1,3-dithietan-2-yl]carbonyl}amino)-7α-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefotetan | ChemIDplus |
| cefotetanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7S)-7-(4-(carbamoylcarboxymethylene)-1,3-dithiethane-2-carboxamido)-7-methoxy-3-(((1-methyl-1H-tetrazol-5- yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2- carboxylic acid | ChemIDplus |
| cefotetan | ChEMBL |
| Cefotetan | KEGG COMPOUND |
| Citations |
|---|