EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N3O2S |
| Net Charge | 0 |
| Average Mass | 287.344 |
| Monoisotopic Mass | 287.07285 |
| SMILES | COc1cc(S(C)=O)ccc1-c1nc2cccnc2n1 |
| InChI | InChI=1S/C14H13N3O2S/c1-19-12-8-9(20(2)18)5-6-10(12)13-16-11-4-3-7-15-14(11)17-13/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | XMFCOYRWYYXZMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | adenosine A1 receptor antagonist An antagonist at the A1 receptor. EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Application: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulmazole (CHEBI:34988) has role adenosine A1 receptor antagonist (CHEBI:63957) |
| sulmazole (CHEBI:34988) has role cardiotonic drug (CHEBI:38147) |
| sulmazole (CHEBI:34988) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| sulmazole (CHEBI:34988) is a imidazopyridine (CHEBI:46908) |
| sulmazole (CHEBI:34988) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 2-[2-methoxy-4-(methylsulfinyl)phenyl]-1H-imidazo[4,5-b]pyridine |
| INNs | Source |
|---|---|
| sulmazol | ChemIDplus |
| sulmazole | ChemIDplus |
| sulmazolum | ChemIDplus |
| Synonym | Source |
|---|---|
| 2-[2-methoxy-4-(methylsulfinyl)phenyl]-3H-imidazo[4,5-b]pyridine | ChemIDplus |