EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@H](O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)C=C(C)C(=O)C2 |
| InChI | InChI=1S/C20H30O2/c1-12-11-20(3)13(10-17(12)21)4-5-14-15-6-7-18(22)19(15,2)9-8-16(14)20/h11,13-16,18,22H,4-10H2,1-3H3/t13-,14-,15-,16-,18-,19-,20-/m0/s1 |
| InChIKey | GYBGISLVORKLBN-YNZDMMAESA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stenbolone (CHEBI:34980) has role androgen (CHEBI:50113) |
| Stenbolone (CHEBI:34980) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 17beta-Hydroxy-2-methyl-5alpha-androst-1-en-3-one | KEGG COMPOUND |
| Stenbolone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14490 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:5197-58-0 | KEGG COMPOUND |