EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N5S |
| Net Charge | 0 |
| Average Mass | 213.310 |
| Monoisotopic Mass | 213.10482 |
| SMILES | CCNc1nc(NCC)nc(SC)n1 |
| InChI | InChI=1S/C8H15N5S/c1-4-9-6-11-7(10-5-2)13-8(12-6)14-3/h4-5H2,1-3H3,(H2,9,10,11,12,13) |
| InChIKey | MGLWZSOBALDPEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simetryn (CHEBI:34976) has role herbicide (CHEBI:24527) |
| simetryn (CHEBI:34976) is a diamino-1,3,5-triazine (CHEBI:38170) |
| simetryn (CHEBI:34976) is a methylthio-1,3,5-triazine (CHEBI:38174) |
| IUPAC Name |
|---|
| N,N'-diethyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| Simetryn | KEGG COMPOUND |
| 2,4-Di(ethylamino)-6-methylthio-1,3,5-triazine | KEGG COMPOUND |
| N,N'-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | NIST Chemistry WebBook |
| 2-methylthio-4,6-bis(ethylamino)-1,3,5-triazine | NIST Chemistry WebBook |
| 2,4-bis(ethylamino)-6-(methylthio)-s-triazine | ChemIDplus |
| N2,N4-diethyl-6-methylthio-1,3,5-triazine-2,4-diamine | ChemIDplus |
| Citations |
|---|