EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO5P |
| Net Charge | 0 |
| Average Mass | 223.165 |
| Monoisotopic Mass | 223.06096 |
| SMILES | O=C(O)[C@@H]1C[C@H](CP(=O)(O)O)CCN1 |
| InChI | InChI=1S/C7H14NO5P/c9-7(10)6-3-5(1-2-8-6)4-14(11,12)13/h5-6,8H,1-4H2,(H,9,10)(H2,11,12,13)/t5-,6+/m1/s1 |
| InChIKey | LPMRCCNDNGONCD-RITPCOANSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Selfotel (CHEBI:34973) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Selfotel | KEGG COMPOUND |