EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28ClFN2OS |
| Net Charge | 0 |
| Average Mass | 483.052 |
| Monoisotopic Mass | 482.15949 |
| SMILES | C#CCN(c1nc(-c2cc(C)c(OC)cc2Cl)c(C)s1)[C@@H](CC1CC1)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C27H28ClFN2OS/c1-6-11-31(24(13-19-8-9-19)20-10-7-16(2)23(29)14-20)27-30-26(18(4)33-27)21-12-17(3)25(32-5)15-22(21)28/h1,7,10,12,14-15,19,24H,8-9,11,13H2,2-5H3/t24-/m0/s1 |
| InChIKey | IEAKXXNRGSLYTQ-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SSR 125543 (CHEBI:34969) has role antidepressant (CHEBI:35469) |
| SSR 125543 (CHEBI:34969) is a amine (CHEBI:32952) |
| Synonyms | Source |
|---|---|
| 06-RORI | ChEMBL |
| crinecerfont | ChEMBL |
| Crinecerfont | ChEMBL |
| NBI-74788 | ChEMBL |
| Ssr-125543 | ChEMBL |
| SSR 125543 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Crenessity | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C14129 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:752253-39-7 | KEGG COMPOUND |
| Citations |
|---|