EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21Cl3N4O |
| Net Charge | 0 |
| Average Mass | 463.796 |
| Monoisotopic Mass | 462.07809 |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21Cl3N4O/c1-14-20(22(30)27-28-11-3-2-4-12-28)26-29(19-10-9-17(24)13-18(19)25)21(14)15-5-7-16(23)8-6-15/h5-10,13H,2-4,11-12H2,1H3,(H,27,30) |
| InChIKey | JZCPYUJPEARBJL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB1 receptor antagonist An antagonist that binds to and deactivates type 1 cannabinoid receptors. anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rimonabant (CHEBI:34967) has role anti-obesity agent (CHEBI:74518) |
| rimonabant (CHEBI:34967) has role appetite depressant (CHEBI:50507) |
| rimonabant (CHEBI:34967) has role CB1 receptor antagonist (CHEBI:73416) |
| rimonabant (CHEBI:34967) is a amidopiperidine (CHEBI:48613) |
| rimonabant (CHEBI:34967) is a carbohydrazide (CHEBI:35363) |
| rimonabant (CHEBI:34967) is a dichlorobenzene (CHEBI:23697) |
| rimonabant (CHEBI:34967) is a monochlorobenzenes (CHEBI:83403) |
| rimonabant (CHEBI:34967) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(piperidin-1-yl)-1H-pyrazole-3-carboxamide |
| INNs | Source |
|---|---|
| rimonabant | WHO MedNet |
| rimonabantum | WHO MedNet |
| rimonabant | WHO MedNet |
| rimonabant | WHO MedNet |
| Synonyms | Source |
|---|---|
| SR 141716 | ChemIDplus |
| SR141716 | ChemIDplus |
| N-(1-piperidinyl)-1-(2,4-dichlorophenyl)-4-methyl-5-(4-chlorophenyl)-1H-pyrazole-3-carboxamide | ChEBI |
| 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-1-piperidinyl-1H-pyrazole-3-carboxamide | ChEBI |
| A 281 | ChEBI |
| Brand Names | Source |
|---|---|
| Zimulti | ChemIDplus |
| Acomplia | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14319 | KEGG COMPOUND |
| D05731 | KEGG DRUG |
| LSM-36994 | LINCS |
| 4150 | DrugCentral |
| HMDB0015623 | HMDB |
| C00053749 | KNApSAcK |
| DB06155 | DrugBank |
| Rimonabant | Wikipedia |
| AY6 | PDBeChem |
| 94641 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:168273-06-1 | ChemIDplus |
| CAS:168273-06-1 | NIST Chemistry WebBook |
| Citations |
|---|