EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N8O6S2 |
| Net Charge | 0 |
| Average Mass | 522.569 |
| Monoisotopic Mass | 522.11037 |
| SMILES | [H][C@]12SCC(Cn3ccc(=N)n3CCO)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H2,21,22)(H,23,29)(H,31,32)/b20-11?,24-12-/t13-,17-/m1/s1 |
| InChIKey | ZINFAXPQMLDEEJ-GFVOIPPFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefoselis (CHEBI:3496) is a 1,3-thiazoles (CHEBI:38418) |
| cefoselis (CHEBI:3496) is a cephalosporin (CHEBI:23066) |
| cefoselis (CHEBI:3496) is a pyrazoles (CHEBI:26410) |
| Incoming Relation(s) |
| cefoselis sulfate (CHEBI:34616) has functional parent cefoselis (CHEBI:3496) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-{[2-(2-hydroxyethyl)-3-imino-2,3-dihydro-1H-pyrazol-1-yl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| céfosélis | WHO MedNet |
| cefoselisum | WHO MedNet |
| cefoselis | ChemIDplus |
| cefoselís | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cefoselis | KEGG COMPOUND |
| wincef | DrugCentral |
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-{[2-(2-hydroxyethyl)-3-imino-2,3-dihydro-1H-pyrazol-1-yl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:122841-10-5 | KEGG COMPOUND |
| CAS:122841-10-5 | ChemIDplus |
| Citations |
|---|