EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N7O6S2 |
| Net Charge | 0 |
| Average Mass | 519.565 |
| Monoisotopic Mass | 519.09947 |
| SMILES | [H][C@]12SCC(CSc3nnnn3CC(=O)O)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)Cc1ccccc1CN |
| InChI | InChI=1S/C20H21N7O6S2/c21-6-11-4-2-1-3-10(11)5-13(28)22-15-17(31)27-16(19(32)33)12(8-34-18(15)27)9-35-20-23-24-25-26(20)7-14(29)30/h1-4,15,18H,5-9,21H2,(H,22,28)(H,29,30)(H,32,33)/t15-,18-/m1/s1 |
| InChIKey | SLAYUXIURFNXPG-CRAIPNDOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceforanide (CHEBI:3495) has role antibacterial drug (CHEBI:36047) |
| ceforanide (CHEBI:3495) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| (6R,7R)-7-({[2-(aminomethyl)phenyl]acetyl}amino)-3-({[1-(carboxymethyl)-1H-tetrazol-5-yl]sulfanyl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| ceforanide | ChemIDplus |
| ceforanido | ChemIDplus |
| ceforanidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-[[2-[2-(aminomethyl)phenyl]acetyl]amino]-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | DrugBank |
| 7-[O-(aminomethyl)phenylacetamido]-3-[[[1-(carboxymethyl)-1H-tetrazol-5-yl]thio]methyl]-3-cephem-4-carboxylic acid | ChEBI |
| 7β-[2-(aminomethyl)phenyl]acetamido-3-{[1-(carboxymethyl)-1H-tetrazol-5-yl]sulfanyl}methyl-3,4-didehydrocepham-4-carboxylic acid | IUPAC |
| Ceforanide | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5399626 | Beilstein |
| CAS:60925-61-3 | KEGG COMPOUND |
| CAS:60925-61-3 | ChemIDplus |