EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h3-4,6-7,12-13,15-18,21-22H,2,5,8-11,14H2,1H3,(H,24,25)/b6-3-,7-4-,13-12+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | ANOICLBSJIMQTA-WXGBOJPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin D3 (CHEBI:34939) has role human metabolite (CHEBI:77746) |
| prostaglandin D3 (CHEBI:34939) is a prostaglandins D (CHEBI:26337) |
| prostaglandin D3 (CHEBI:34939) is conjugate acid of prostaglandin D3(1−) (CHEBI:132149) |
| Incoming Relation(s) |
| prostaglandin D3(1−) (CHEBI:132149) is conjugate base of prostaglandin D3 (CHEBI:34939) |
| IUPAC Name |
|---|
| (5Z,13E,15S,17Z)-9α,15-dihydroxy-11-oxoprosta-5,13,17-trien-1-oic acid |
| Synonyms | Source |
|---|---|
| (5Z,13E,15S,17Z)-9alpha,15-dihydroxy-11-oxoprosta-5,13,17-trien-1-oic acid | HMDB |
| (5Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dien-1-yl]-3-oxocyclopentyl]hept-5-enoic acid | HMDB |
| 9S,15S-Dihydroxy-11-oxo-5Z,13E,17Z-prostatrienoic acid | HMDB |
| Prostaglandin D3 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13802 | KEGG COMPOUND |
| HMDB0003034 | HMDB |
| LMFA03010142 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5995201 | Reaxys |
| CAS:71902-47-1 | ChemIDplus |
| CAS:71902-47-1 | KEGG COMPOUND |
| Citations |
|---|