EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N9O8S2 |
| Net Charge | 0 |
| Average Mass | 645.680 |
| Monoisotopic Mass | 645.14240 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)[C@H](NC(=O)N1CCN(CC)C(=O)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H27N9O8S2/c1-3-32-8-9-33(21(39)20(32)38)24(42)27-15(12-4-6-14(35)7-5-12)18(36)26-16-19(37)34-17(23(40)41)13(10-43-22(16)34)11-44-25-28-29-30-31(25)2/h4-7,15-16,22,35H,3,8-11H2,1-2H3,(H,26,36)(H,27,42)(H,40,41)/t15-,16-,22-/m1/s1 |
| InChIKey | GCFBRXLSHGKWDP-XCGNWRKASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefoperazone (CHEBI:3493) has role antibacterial drug (CHEBI:36047) |
| cefoperazone (CHEBI:3493) is a cephalosporin (CHEBI:23066) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2R)-2-{[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}-2-(4-hydroxyphenyl)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-{[(2R)-2-{[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}-2-(4-hydroxyphenyl)acetyl]amino}-3-[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefoperazone | ChemIDplus |
| cefoperazono | ChemIDplus |
| cefoperazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | DrugBank |
| (6R,7R)-7-((R)-2-(4-Ethyl-2,3-dioxo-1-piperazinylcarboxamido)-2-(4-hydroxyphenyl)acetamido)-3-((1-methyl-1H-tetrazol-5-yl)thiomethyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-2-carbonsaeure | ChemIDplus |
| cefobid | ChEBI |
| cefoperazon | ChEBI |
| Cefoperazone | KEGG COMPOUND |
| CPZ | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6050252 | Reaxys |
| CAS:62893-19-0 | ChemIDplus |
| CAS:62893-19-0 | KEGG COMPOUND |
| Citations |
|---|