EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N5.H2O |
| Net Charge | 0 |
| Average Mass | 263.345 |
| Monoisotopic Mass | 263.17461 |
| SMILES | CC(N/C(=N/c1ccncc1)NC#N)C(C)(C)C.O |
| InChI | InChI=1S/C13H19N5.H2O/c1-10(13(2,3)4)17-12(16-9-14)18-11-5-7-15-8-6-11;/h5-8,10H,1-4H3,(H2,15,16,17,18);1H2 |
| InChIKey | AFJCNBBHEVLGCZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pinacidil (CHEBI:34923) has role antihypertensive agent (CHEBI:35674) |
| Pinacidil (CHEBI:34923) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| NSC-759588 | ChEMBL |
| Pinacidil | KEGG COMPOUND |