EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H18N8 |
| Net Charge | 0 |
| Average Mass | 514.552 |
| Monoisotopic Mass | 514.16544 |
| SMILES | c1ccc2c(c1)-c1nc-2nc2nc(nc3nc(nc4nc(n1)c1ccccc14)-c1ccccc1-3)c1ccccc21 |
| InChI | InChI=1S/C32H18N8/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25/h1-16H,(H2,33,34,35,36,37,38,39,40) |
| InChIKey | IEQIEDJGQAUEQZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phthalocyanine (CHEBI:34921) has role antineoplastic agent (CHEBI:35610) |
| phthalocyanine (CHEBI:34921) is a organic molecular entity (CHEBI:50860) |
| phthalocyanine (CHEBI:34921) is a phthalocyanines (CHEBI:51580) |
| phthalocyanine (CHEBI:34921) is a tetrapyrrole fundamental parent (CHEBI:35794) |
| IUPAC Name |
|---|
| phthalocyanine |
| Synonyms | Source |
|---|---|
| 29H,31H-Phthalocyanine | KEGG COMPOUND |
| ciaftalan | ChEMBL |
| Ciaftalan | ChEMBL |
| ftalocianina | ChEBI |
| Phthalocyanin | ChEBI |
| Phthalocyanine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14077 | KEGG COMPOUND |
| DB12983 | DrugBank |
| Phthalocyanine | Wikipedia |
| Citations |
|---|