EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O4 |
| Net Charge | 0 |
| Average Mass | 318.328 |
| Monoisotopic Mass | 318.08921 |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12,21-22H |
| InChIKey | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenolphthalein (CHEBI:34914) has functional parent 2-benzofuran-1(3H)-one (CHEBI:38085) |
| phenolphthalein (CHEBI:34914) has role laxative (CHEBI:50503) |
| phenolphthalein (CHEBI:34914) is a phenols (CHEBI:33853) |
| INNs | Source |
|---|---|
| fenolftaleina | WHO MedNet |
| phenolphtaleine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,3-Bis(4-hydroxyphenyl)phthalide | KEGG COMPOUND |
| euchessina | DrugCentral |
| Phenolphthalein | KEGG COMPOUND |
| phthalimetten | DrugCentral |
| phthalin | DrugCentral |
| Brand Name | Source |
|---|---|
| Alophen | ChEMBL |
| Citations |
|---|