EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N6O8S3 |
| Net Charge | 0 |
| Average Mass | 542.577 |
| Monoisotopic Mass | 542.03482 |
| SMILES | [H][C@]12SCC(CSc3nnnn3CS(=O)(=O)O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H18N6O8S3/c25-13(9-4-2-1-3-5-9)14(26)19-11-15(27)24-12(17(28)29)10(6-33-16(11)24)7-34-18-20-21-22-23(18)8-35(30,31)32/h1-5,11,13,16,25H,6-8H2,(H,19,26)(H,28,29)(H,30,31,32)/t11-,13-,16-/m1/s1 |
| InChIKey | DYAIAHUQIPBDIP-AXAPSJFSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefonicid (CHEBI:3491) has role antibacterial drug (CHEBI:36047) |
| cefonicid (CHEBI:3491) is a cephalosporin (CHEBI:23066) |
| cefonicid (CHEBI:3491) is conjugate acid of cefonicid(2−) (CHEBI:52441) |
| Incoming Relation(s) |
| cefonicid(2−) (CHEBI:52441) is conjugate base of cefonicid (CHEBI:3491) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-hydroxy-2-phenylacetamido]-3-({[1-(sulfomethyl)-1H-tetrazol-5-yl]sulfanyl}methyl)ceph-3-em-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefonicid | KEGG DRUG |
| cefonicido | DrugBank |
| cefonicidum | DrugBank |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-hydroxy-2-phenylacetyl]amino}-8-oxo-3-({[1-(sulfomethyl)-1H-tetrazol-5-yl]sulfanyl}methyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Cefonicid | KEGG COMPOUND |
| Citations |
|---|