EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6Cl5NO2 |
| Net Charge | 0 |
| Average Mass | 295.336 |
| Monoisotopic Mass | 292.83717 |
| SMILES | O=[N+]([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| InChIKey | LKPLKUMXSAEKID-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentachloronitrobenzene (CHEBI:34908) has role antifungal agrochemical (CHEBI:86328) |
| pentachloronitrobenzene (CHEBI:34908) is a C-nitro compound (CHEBI:35716) |
| pentachloronitrobenzene (CHEBI:34908) is a aromatic fungicide (CHEBI:87034) |
| pentachloronitrobenzene (CHEBI:34908) is a pentachlorobenzenes (CHEBI:83390) |
| IUPAC Name |
|---|
| 1,2,3,4,5-pentachloro-6-nitrobenzene |
| Synonyms | Source |
|---|---|
| 2,3,4,5,6-pentachloronitrobenzene | ChEBI |
| nitropentachlorobenzene | ChemIDplus |
| PCNB | KEGG COMPOUND |
| pentachlornitrobenzol | NIST Chemistry WebBook |
| Pentachlornitrobenzol | ChemIDplus |
| Pentachloronitrobenzene | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Avicol | NIST Chemistry WebBook |
| Batrilex | NIST Chemistry WebBook |
| Botrilex | NIST Chemistry WebBook |
| Brassicol | NIST Chemistry WebBook |
| Earthcide | NIST Chemistry WebBook |
| Fartox | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 581 | PPDB |
| C14338 | KEGG COMPOUND |
| Pentachloronitrobenzene | Wikipedia |
| quintozene | Alan Wood's Pesticides |
| US7629159 | Patent |
| Citations |
|---|