EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33NO4 |
| Net Charge | 0 |
| Average Mass | 435.564 |
| Monoisotopic Mass | 435.24096 |
| SMILES | [H][C@@]12CC[C@@]3(O)C4=CC(=O)[C@@H](C(C)(C)O)O[C@@]4([H])CC[C@]3(C)[C@@]1(C)c1nc3ccccc3c1C2 |
| InChI | InChI=1S/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
| InChIKey | ACNHBCIZLNNLRS-UBGQALKQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (23311903) | |
| Penicillium paxilli (ncbitaxon:70109) | - | PubMed (17428785) | |
| Penicillium shearii (ncbitaxon:904690) | - | PubMed (24894186) | Species also known as Eupenicillium shearii. |
| Roles Classification |
|---|
| Biological Roles: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Ca2+-transporting ATPase (EC 3.6.3.8). genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. mycotoxin Poisonous substance produced by fungi. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paxilline (CHEBI:34907) has role Aspergillus metabolite (CHEBI:76956) |
| paxilline (CHEBI:34907) has role Penicillium metabolite (CHEBI:76964) |
| paxilline (CHEBI:34907) has role anticonvulsant (CHEBI:35623) |
| paxilline (CHEBI:34907) has role EC 3.6.3.8 (Ca2+-transporting ATPase) inhibitor (CHEBI:60186) |
| paxilline (CHEBI:34907) has role genotoxin (CHEBI:50902) |
| paxilline (CHEBI:34907) has role geroprotector (CHEBI:176497) |
| paxilline (CHEBI:34907) has role mycotoxin (CHEBI:25442) |
| paxilline (CHEBI:34907) has role potassium channel blocker (CHEBI:50509) |
| paxilline (CHEBI:34907) is a diterpene alkaloid (CHEBI:23847) |
| paxilline (CHEBI:34907) is a enone (CHEBI:51689) |
| paxilline (CHEBI:34907) is a organic heterohexacyclic compound (CHEBI:51914) |
| paxilline (CHEBI:34907) is a terpenoid indole alkaloid (CHEBI:65321) |
| paxilline (CHEBI:34907) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2R,4bS,6aS,12bS,12cR,14aS)-4b-hydroxy-2-(2-hydroxypropan-2-yl)-12b,12c-dimethyl-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-2H-chromeno[5',6':6,7]indeno[1,2-b]indol-3(4bH)-one |
| Synonyms | Source |
|---|---|
| (2R,4bS,6aS,12bS,12cR,14aS)-4b-hydroxy-2-(2-hydroxypropan-2-yl)-12b,12c-dimethyl-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-2H-[1]benzopyrano[5',6':6,7]indeno[1,2-b]indol-3(4bH)-one | IUPAC |
| paxiline | ChEBI |
| paxillin | ChEBI |
| (+)-paxilline | ChEBI |
| UniProt Name | Source |
|---|---|
| paxilline | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5317894 | Reaxys |
| CAS:57186-25-1 | ChemIDplus |
| Citations |
|---|