EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33NO4 |
| Net Charge | 0 |
| Average Mass | 435.564 |
| Monoisotopic Mass | 435.24096 |
| SMILES | [H][C@@]12CC[C@@]3(O)C4=CC(=O)[C@@H](C(C)(C)O)O[C@@]4([H])CC[C@]3(C)[C@@]1(C)c1nc3ccccc3c1C2 |
| InChI | InChI=1S/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
| InChIKey | ACNHBCIZLNNLRS-UBGQALKQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (23311903) | |
| Penicillium paxilli (ncbitaxon:70109) | - | PubMed (17428785) | |
| Penicillium shearii (ncbitaxon:904690) | - | PubMed (24894186) | Species also known as Eupenicillium shearii. |
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Ca2+-transporting ATPase (EC 3.6.3.8). potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. mycotoxin Poisonous substance produced by fungi. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paxilline (CHEBI:34907) has role Aspergillus metabolite (CHEBI:76956) |
| paxilline (CHEBI:34907) has role Penicillium metabolite (CHEBI:76964) |
| paxilline (CHEBI:34907) has role anticonvulsant (CHEBI:35623) |
| paxilline (CHEBI:34907) has role EC 3.6.3.8 (Ca2+-transporting ATPase) inhibitor (CHEBI:60186) |
| paxilline (CHEBI:34907) has role genotoxin (CHEBI:50902) |
| paxilline (CHEBI:34907) has role geroprotector (CHEBI:176497) |
| paxilline (CHEBI:34907) has role mycotoxin (CHEBI:25442) |
| paxilline (CHEBI:34907) has role potassium channel blocker (CHEBI:50509) |
| paxilline (CHEBI:34907) is a diterpene alkaloid (CHEBI:23847) |
| paxilline (CHEBI:34907) is a enone (CHEBI:51689) |
| paxilline (CHEBI:34907) is a organic heterohexacyclic compound (CHEBI:51914) |
| paxilline (CHEBI:34907) is a terpenoid indole alkaloid (CHEBI:65321) |
| paxilline (CHEBI:34907) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2R,4bS,6aS,12bS,12cR,14aS)-4b-hydroxy-2-(2-hydroxypropan-2-yl)-12b,12c-dimethyl-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-2H-chromeno[5',6':6,7]indeno[1,2-b]indol-3(4bH)-one |
| Synonyms | Source |
|---|---|
| (2R,4bS,6aS,12bS,12cR,14aS)-4b-hydroxy-2-(2-hydroxypropan-2-yl)-12b,12c-dimethyl-5,6,6a,7,12,12b,12c,13,14,14a-decahydro-2H-[1]benzopyrano[5',6':6,7]indeno[1,2-b]indol-3(4bH)-one | IUPAC |
| paxiline | ChEBI |
| paxillin | ChEBI |
| (+)-paxilline | ChEBI |
| UniProt Name | Source |
|---|---|
| paxilline | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5317894 | Reaxys |
| CAS:57186-25-1 | ChemIDplus |
| Citations |
|---|