EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2 |
| Net Charge | +2 |
| Average Mass | 186.258 |
| Monoisotopic Mass | 186.11460 |
| SMILES | C[n+]1ccc(-c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 |
| InChIKey | INFDPOAKFNIJBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | herbicide A substance used to destroy plant pests. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraquat (CHEBI:34905) has parent hydride 4,4'-bipyridine (CHEBI:30985) |
| paraquat (CHEBI:34905) has role geroprotector (CHEBI:176497) |
| paraquat (CHEBI:34905) has role herbicide (CHEBI:24527) |
| paraquat (CHEBI:34905) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| paraquat dichloride (CHEBI:28786) has part paraquat (CHEBI:34905) |
| paraquat dichloride hydrate (CHEBI:233354) has part paraquat (CHEBI:34905) |
| IUPAC Name |
|---|
| 1,1'-dimethyl-[4,4'-bipyridin]-1,1'-diium |
| Synonyms | Source |
|---|---|
| Paraquat | KEGG COMPOUND |
| 1,1'-Dimethyl-4,4'-bipyridinium | KEGG COMPOUND |
| 1,1'-dimethyl-4,4'-bipyridyldiylium | ChemIDplus |
| dimethyl viologen | ChemIDplus |
| methyl viologen ion(2+) | ChemIDplus |
| N,N'-dimethyl-4,4'-bipyridinium | ChemIDplus |
| Citations |
|---|