EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12CCC3=C(O)C(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C20H30O3/c1-18-9-8-16(21)17(22)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,3)23/h12-14,22-23H,4-11H2,1-3H3/t12-,13+,14+,18-,19+,20+/m1/s1 |
| InChIKey | RXXBBHGCAXVBES-XMUHMHRVSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oranabol (CHEBI:34903) has role androgen (CHEBI:50113) |
| Oranabol (CHEBI:34903) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 4,17beta-Dihydroxy-17alpha-methylandrost-4-en-3-one | KEGG COMPOUND |
| 4-Hydroxy-17alpha-methyltestosterone | KEGG COMPOUND |
| anamidol | DrugCentral |
| aranabol | DrugCentral |
| methandrostenediolone | DrugCentral |
| oranabol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2031 | DrugCentral |
| C14665 | KEGG COMPOUND |
| HMDB0006027 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:145-12-0 | KEGG COMPOUND |