EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N7O5S3.Na |
| Net Charge | 0 |
| Average Mass | 493.528 |
| Monoisotopic Mass | 493.02727 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)[O-])N1C(=O)[C@]2(NC(=O)CSCC#N)OC.[Na+] |
| InChI | InChI=1S/C15H17N7O5S3.Na/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25;/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25);/q;+1/p-1/t13-,15+;/m1./s1 |
| InChIKey | BITQGIOJQWZUPL-PBCQUBLHSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefmetazole sodium (CHEBI:3490) has part cefmetazole(1−) (CHEBI:52439) |
| cefmetazole sodium (CHEBI:3490) has role antimicrobial agent (CHEBI:33281) |
| cefmetazole sodium (CHEBI:3490) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 6β-{[(cyanomethyl)sulfanyl]acetamido}-6α-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate |
| Synonyms | Source |
|---|---|
| Cefmetazole sodium | KEGG COMPOUND |
| Cefmetazon | ChemIDplus |
| cefmetazone | ChEBI |
| CMZ | KEGG DRUG |
| CMZ sodium | ChemIDplus |
| CS 1170 sodium | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5403925 | Reaxys |
| CAS:56796-39-5 | KEGG COMPOUND |
| CAS:56796-39-5 | ChemIDplus |
| Citations |
|---|