EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11N3O3S |
| Net Charge | 0 |
| Average Mass | 301.327 |
| Monoisotopic Mass | 301.05211 |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)c3cccs3)cc2n1 |
| InChI | InChI=1S/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19) |
| InChIKey | KYRVNWMVYQXFEU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocodazole (CHEBI:34892) has role antimitotic (CHEBI:64911) |
| nocodazole (CHEBI:34892) has role antineoplastic agent (CHEBI:35610) |
| nocodazole (CHEBI:34892) has role microtubule-destabilising agent (CHEBI:61951) |
| nocodazole (CHEBI:34892) has role tubulin modulator (CHEBI:60832) |
| nocodazole (CHEBI:34892) is a aromatic ketone (CHEBI:76224) |
| nocodazole (CHEBI:34892) is a benzimidazoles (CHEBI:22715) |
| nocodazole (CHEBI:34892) is a carbamate ester (CHEBI:23003) |
| nocodazole (CHEBI:34892) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| methyl [5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]carbamate |
| INNs | Source |
|---|---|
| nocodazole | KEGG DRUG |
| nocodazolum | ChemIDplus |
| nocodazol | ChemIDplus |
| nocodazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| methyl (5-(2-thienylcarbonyl))-1H-benzimidazole-2-ylcarbamate | ChemIDplus |
| N-(5-(2-thenoyl)-2-benzimidazolyl)carbamic acid methyl ester | ChemIDplus |
| (5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl)-carbamic acid methyl ester | ChemIDplus |
| oncodazole | ChemIDplus |
| N-(5-(2-thienoyl)-2-benzimidazolyl)carbamic acid methyl ester | NIST Chemistry WebBook |
| methyl N-(5-thenoyl-2-benzimidazolyl)carbamate | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1085978 | Reaxys |
| CAS:31430-18-9 | KEGG COMPOUND |
| CAS:31430-18-9 | ChemIDplus |
| CAS:31430-18-9 | NIST Chemistry WebBook |
| Citations |
|---|