EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N7O5S3 |
| Net Charge | 0 |
| Average Mass | 471.546 |
| Monoisotopic Mass | 471.04533 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)CSCC#N)OC |
| InChI | InChI=1S/C15H17N7O5S3/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25)/t13-,15+/m1/s1 |
| InChIKey | SNBUBQHDYVFSQF-HIFRSBDPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefmetazole (CHEBI:3489) has role antibacterial drug (CHEBI:36047) |
| cefmetazole (CHEBI:3489) is a cephalosporin (CHEBI:23066) |
| cefmetazole (CHEBI:3489) is conjugate acid of cefmetazole(1−) (CHEBI:52439) |
| Incoming Relation(s) |
| cefmetazole(1−) (CHEBI:52439) is conjugate base of cefmetazole (CHEBI:3489) |
| IUPAC Name |
|---|
| 7β-{[(cyanomethyl)sulfanyl]acetamido}-7α-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefmetazole | KEGG DRUG |
| cefmetazolo | DrugBank |
| cefmetazolum | DrugBank |
| Synonym | Source |
|---|---|
| (6R,7S)-7-({[(cyanomethyl)sulfanyl]acetyl}amino)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406306 | Beilstein |
| CAS:56796-20-4 | ChemIDplus |
| CAS:56796-20-4 | KEGG COMPOUND |
| Citations |
|---|