EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48N7O19P3S |
| Net Charge | 0 |
| Average Mass | 1007.799 |
| Monoisotopic Mass | 1007.19385 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H48N7O19P3S/c1-36(2,30(48)33(49)39-10-9-25(44)38-11-12-66-35(50)23(15-26(45)46)14-20-7-8-21-5-3-4-6-22(21)13-20)17-59-65(56,57)62-64(54,55)58-16-24-29(61-63(51,52)53)28(47)34(60-24)43-19-42-27-31(37)40-18-41-32(27)43/h3-8,13,18-19,23-24,28-30,34,47-48H,9-12,14-17H2,1-2H3,(H,38,44)(H,39,49)(H,45,46)(H,54,55)(H,56,57)(H2,37,40,41)(H2,51,52,53)/t23?,24-,28-,29-,30+,34-/m1/s1 |
| InChIKey | BLFNYMNSRZKVBB-JIFARLPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | acyl donor Any donor that can transfer acyl groups between molecular entities. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthyl-2-methyl-succinyl-CoA (CHEBI:34884) has functional parent Naphthyl-2-methyl-succinic acid (CHEBI:34883) |
| naphthyl-2-methyl-succinyl-CoA (CHEBI:34884) is a acyl-CoA (CHEBI:17984) |
| naphthyl-2-methyl-succinyl-CoA (CHEBI:34884) is a monocarboxylic acid (CHEBI:25384) |
| naphthyl-2-methyl-succinyl-CoA (CHEBI:34884) is a naphthalenes (CHEBI:25477) |
| IUPAC Name |
|---|
| (9R)-1-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]-3,5,9-trihydroxy-8,8-dimethyl-20-(naphthalen-2-ylmethyl)-10,14,19-trioxo-2,4,6-trioxa-18-thia-11,15-diaza-3,5-diphosphadocosan-22-oic acid 3,5-dioxide |
| Synonyms | Source |
|---|---|
| naphthyl-2-methyl-succinyl-CoA | KEGG COMPOUND |
| 2-(2-naphthylmethyl)succinyl-CoA | ChEBI |
| S-[4-hydrogen 2-(2-naphthalenylmethyl)butanedioate]coenzyme A | ChEBI |
| S-[4-hydrogen (2-naphthalenylmethyl)butanedioate]coenzyme A | ChEBI |
| naphthyl-2-methyl-succinyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14116 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:830357-87-4 | KEGG COMPOUND |
| Citations |
|---|