EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25FN8O6S2 |
| Net Charge | 0 |
| Average Mass | 556.602 |
| Monoisotopic Mass | 556.13225 |
| SMILES | [H][C@]12SCC(/C=C/C[N+](C)(CC)CC(N)=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OCF)c1nsc(N)n1 |
| InChI | InChI=1S/C20H25FN8O6S2/c1-3-29(2,7-11(22)30)6-4-5-10-8-36-18-13(17(32)28(18)14(10)19(33)34)24-16(31)12(26-35-9-21)15-25-20(23)37-27-15/h4-5,13,18H,3,6-9H2,1-2H3,(H5-,22,23,24,25,27,30,31,33,34)/b5-4+,26-12-/t13-,18-,29?/m1/s1 |
| InChIKey | XAKKNLNAJBNLPC-MAYKBZFQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefluprenam (CHEBI:3488) has role antimicrobial agent (CHEBI:33281) |
| cefluprenam (CHEBI:3488) is a cephalosporin (CHEBI:23066) |
| cefluprenam (CHEBI:3488) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-({(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(fluoromethoxy)imino]acetyl}amino)-3-[(1E)-3-[(2-amino-2-oxoethyl)(ethyl)methylazaniumyl]prop-1-en-1-yl]-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefluprenamum | WHO MedNet |
| céfluprénam | WHO MedNet |
| cefluprenam | WHO MedNet |
| cefluprenam | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-3-{(1E)-3-[(2-amino-2-oxoethyl)(ethyl)methylazaniumyl]prop-1-en-1-yl}-7-({(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(fluoromethoxy)imino]acetyl}amino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Antibiotic E 1077 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01054 | KEGG DRUG |
| Cefluprenam | Wikipedia |
| US5994340 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:116853-25-9 | ChemIDplus |
| Citations |
|---|