EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8F6N2O2 |
| Net Charge | 0 |
| Average Mass | 362.229 |
| Monoisotopic Mass | 362.04900 |
| SMILES | O=c1nc2cc(C(F)(F)F)ccc2n1-c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C15H8F6N2O2/c16-14(17,18)7-1-3-10-9(5-7)22-13(25)23(10)11-6-8(15(19,20)21)2-4-12(11)24/h1-6,24H,(H,22,25) |
| InChIKey | YLFMCMWKHSDUCT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | potassium channel opener A potassium channel modulator that opens the potassium channel. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NS 1619 (CHEBI:34879) has role potassium channel opener (CHEBI:79085) |
| NS 1619 (CHEBI:34879) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| NS 1619 (CHEBI:34879) is a benzimidazoles (CHEBI:22715) |
| NS 1619 (CHEBI:34879) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-[2-hydroxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-1,3-dihydro-2H-benzimidazol-2-one |
| Synonyms | Source |
|---|---|
| 1-(2'-hydroxy-5'-trifluoromethylphenyl)-5-trifluoromethyl-2(3H)-benzimidazolone | ChemIDplus |
| 1,3-dihydro-1-[2-hydroxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-benzimidazol-2-one | ChEBI |
| 5-trifluoromethyl-2,3-dihydro-1-(5-trifluoromethyl-2-hydroxyphenyl)-1H-2-oxo-benzimidazole | ChEBI |
| NS-1619 | ChemIDplus |
| NS1619 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8165035 | Reaxys |
| CAS:153587-01-0 | KEGG COMPOUND |
| CAS:153587-01-0 | ChemIDplus |
| Citations |
|---|