EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4N2OS |
| Net Charge | 0 |
| Average Mass | 128.156 |
| Monoisotopic Mass | 128.00443 |
| SMILES | O=c1ccnc(=S)n1 |
| InChI | InChI=1S/C4H4N2OS/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| InChIKey | ZEMGGZBWXRYJHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiouracil (CHEBI:348530) has functional parent uracil (CHEBI:17568) |
| thiouracil (CHEBI:348530) has role antithyroid drug (CHEBI:50671) |
| thiouracil (CHEBI:348530) has role metabolite (CHEBI:25212) |
| thiouracil (CHEBI:348530) is a nucleobase analogue (CHEBI:67142) |
| thiouracil (CHEBI:348530) is a thiocarbonyl compound (CHEBI:50492) |
| IUPAC Name |
|---|
| 2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 2-mercapto-4-pyrimidinol | NIST Chemistry WebBook |
| 2-Mercapto-pyrimidin-4-ol | ChEMBL |
| 2-Thio-2,4-(1H,3H)-pyrimidinedione | ChemIDplus |
| 2-Thiouracil | NIST Chemistry WebBook |
| 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one | ChEMBL |
| 4-Hydroxy-2-pyrimidinethiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2640 | DrugCentral |
| C19304 | KEGG COMPOUND |
| Thiouracil | Wikipedia |
| Citations |
|---|