EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4N2OS |
| Net Charge | 0 |
| Average Mass | 128.156 |
| Monoisotopic Mass | 128.00443 |
| SMILES | O=c1ccnc(=S)n1 |
| InChI | InChI=1S/C4H4N2OS/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| InChIKey | ZEMGGZBWXRYJHK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiouracil (CHEBI:348530) has functional parent uracil (CHEBI:17568) |
| thiouracil (CHEBI:348530) has role antithyroid drug (CHEBI:50671) |
| thiouracil (CHEBI:348530) has role metabolite (CHEBI:25212) |
| thiouracil (CHEBI:348530) is a nucleobase analogue (CHEBI:67142) |
| thiouracil (CHEBI:348530) is a thiocarbonyl compound (CHEBI:50492) |
| IUPAC Name |
|---|
| 2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 2-Mercapto-pyrimidin-4-ol | ChEMBL |
| 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one | ChEMBL |
| 2-Thiouracil | NIST Chemistry WebBook |
| 2-Thio-2,4-(1H,3H)-pyrimidinedione | ChemIDplus |
| 2-mercapto-4-pyrimidinol | NIST Chemistry WebBook |
| 4-Hydroxy-2-pyrimidinethiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Thiouracil | Wikipedia |
| C19304 | KEGG COMPOUND |
| 2640 | DrugCentral |
| Citations |
|---|