EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3(C)O)[C@]1([H])[C@H](C)CC1=CC(=O)CC[C@@]12[H] |
| InChI | InChI=1S/C20H30O2/c1-12-10-13-11-14(21)4-5-15(13)16-6-8-19(2)17(18(12)16)7-9-20(19,3)22/h11-12,15-18,22H,4-10H2,1-3H3/t12-,15+,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | PTQMMNYJKCSPET-OMHQDGTGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mibolerone (CHEBI:34849) has parent hydride estrane (CHEBI:23966) |
| mibolerone (CHEBI:34849) has role anabolic agent (CHEBI:36413) |
| mibolerone (CHEBI:34849) has role androgen (CHEBI:50113) |
| mibolerone (CHEBI:34849) is a 17β-hydroxy steroid (CHEBI:35343) |
| mibolerone (CHEBI:34849) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| IUPAC Name |
|---|
| 17β-hydroxy-7α,17-dimethylestr-4-en-3-one |
| INNs | Source |
|---|---|
| mibolerona | ChemIDplus |
| mibolerone | KEGG DRUG |
| mibolérone | WHO MedNet |
| miboleronum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-beta-Hydroxy-7-alpha,17-dimethylestr-4-en-3-one | KEGG COMPOUND |
| 7α-17α-dimethyl-19-nortestosterone | ChemIDplus |
| (7α,17β)-17-hydroxy-7,17-dimethylestr-4-en-3-one | IUPAC |
| NSC 72260 | ChemIDplus |
| U 10997 | ChemIDplus |
| U-10,997 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14255 | KEGG COMPOUND |
| D05025 | KEGG DRUG |
| Mibolerone | Wikipedia |
| US2002012694 | Patent |
| US2002193359 | Patent |
| US4412993 | Patent |
| US5342834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5565683 | Reaxys |
| CAS:3704-09-4 | KEGG COMPOUND |
| CAS:3704-09-4 | ChemIDplus |
| Citations |
|---|