EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N8O6S2 |
| Net Charge | 0 |
| Average Mass | 550.623 |
| Monoisotopic Mass | 550.14167 |
| SMILES | [H][C@]12SCC(C[N+]34CCC(C(N)=O)(CC3)CC4)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1nsc(N)n1 |
| InChI | InChI=1S/C21H26N8O6S2/c1-35-26-11(14-25-20(23)37-27-14)15(30)24-12-16(31)28-13(18(32)33)10(9-36-17(12)28)8-29-5-2-21(3-6-29,4-7-29)19(22)34/h12,17H,2-9H2,1H3,(H5-,22,23,24,25,27,30,32,33,34)/b26-11-/t12-,17-,21?,29?/m1/s1 |
| InChIKey | JUVHVMCKLDZLGN-TVNFHGJBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefclidin (CHEBI:3484) is a cephalosporin (CHEBI:23066) |
| cefclidin (CHEBI:3484) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(4-carbamoyl-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefclidin | ChemIDplus |
| cefclidina | ChemIDplus |
| cefclidine | ChemIDplus |
| cefclidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methoxyimino)acetyl]amino}-3-[(4-carbamoyl-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| cefaclidine | ChemIDplus |
| Cefclidin | KEGG COMPOUND |
| cefclidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6472271 | Reaxys |
| CAS:105239-91-6 | KEGG COMPOUND |
| CAS:105239-91-6 | ChemIDplus |
| Citations |
|---|