EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34837 - methidathion
| Formula | C6H11N2O4PS3 |
| Net Charge | 0 |
| Average Mass | 302.339 |
| Monoisotopic Mass | 301.96186 |
| SMILES | COc1nn(CSP(=S)(OC)OC)c(=O)s1 |
| InChI | InChI=1S/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3 |
| InChIKey | MEBQXILRKZHVCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methidathion (CHEBI:34837) has functional parent 5-methoxy-1,3,4-thiadiazol-2(3H)-one (CHEBI:38723) |
| methidathion (CHEBI:34837) has role acaricide (CHEBI:22153) |
| methidathion (CHEBI:34837) has role agrochemical (CHEBI:33286) |
| methidathion (CHEBI:34837) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| methidathion (CHEBI:34837) is a organic thiophosphate (CHEBI:37512) |
| methidathion (CHEBI:34837) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl phosphorodithioate |
| Synonyms | Source |
|---|---|
| Methidathion | KEGG COMPOUND |
| S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl dithiophosphate | IUPAC |
| Supracide | ChemIDplus |
| phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester | NIST Chemistry WebBook |
| S-(2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-methyl) dimethyl phosphorothiolothionate | ChemIDplus |