EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34834 - Methandriol
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C20H32O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h4,14-17,21-22H,5-12H2,1-3H3/t14-,15+,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | WRWBCPJQPDHXTJ-DTMQFJJTSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methandriol (CHEBI:34834) has role androgen (CHEBI:50113) |
| Methandriol (CHEBI:34834) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| androdiol | DrugCentral |
| diolandrone | DrugCentral |
| mestenediol | DrugCentral |
| metandiol | DrugCentral |
| metandriol | DrugCentral |
| methanabol | DrugCentral |