EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N |
| Net Charge | 0 |
| Average Mass | 179.307 |
| Monoisotopic Mass | 179.16740 |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2 |
| InChI | InChI=1S/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3 |
| InChIKey | BUGYDGFZZOZRHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antiparkinson drug A drug used in the treatment of Parkinson's disease. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| memantine (CHEBI:64312) has parent hydride adamantane (CHEBI:40519) |
| memantine (CHEBI:64312) has role antidepressant (CHEBI:35469) |
| memantine (CHEBI:64312) has role antiparkinson drug (CHEBI:48407) |
| memantine (CHEBI:64312) has role dopaminergic agent (CHEBI:48560) |
| memantine (CHEBI:64312) has role neuroprotective agent (CHEBI:63726) |
| memantine (CHEBI:64312) has role NMDA receptor antagonist (CHEBI:60643) |
| memantine (CHEBI:64312) is a adamantanes (CHEBI:51339) |
| memantine (CHEBI:64312) is a primary aliphatic amine (CHEBI:17062) |
| memantine (CHEBI:64312) is conjugate base of memantinium(1+) (CHEBI:64325) |
| Incoming Relation(s) |
| memantinium(1+) (CHEBI:64325) is conjugate acid of memantine (CHEBI:64312) |
| IUPAC Name |
|---|
| 3,5-dimethyladamantan-1-amine |
| INNs | Source |
|---|---|
| memantina | DrugBank |
| memantine | KEGG DRUG |
| memantinum | DrugBank |
| Synonyms | Source |
|---|---|
| 1,3-Dimethyl-5-adamantanamine | ChemIDplus |
| 1-Amino-3,5-dimethyladamantane | ChemIDplus |
| 3,5-Dimethyl-1-adamantanamine | NIST Chemistry WebBook |
| 3,5-Dimethyl-1-aminoadamantane | ChEBI |
| 3,5-Dimethyltricyclo(3.3.1.1(3,7))decan-1-amine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2075983 | Reaxys |
| CAS:19982-08-2 | KEGG COMPOUND |
| CAS:19982-08-2 | ChemIDplus |
| CAS:19982-08-2 | NIST Chemistry WebBook |
| Citations |
|---|